C28H31N7O2S — CID 130241193
3-[2-(3-amino-2-methanimidoylphenyl)-4-morpholin-4-ylthieno[3,2-d]pyrimidin-6-yl]-N-[2-(dimethylamino)ethyl]benzamide (PubChem CID 130241193) has the molecular formula C28H31N7O2S and a molecular weight of 529.67 g/mol. Its IUPAC name is 3-[2-(3-amino-2-methanimidoylphenyl)-4-morpholin-4-ylthieno[3,2-d]pyrimidin-6-yl]-N-[2-(dimethylamino)ethyl]benzamide.
| Compound Name | 3-[2-(3-amino-2-methanimidoylphenyl)-4-morpholin-4-ylthieno[3,2-d]pyrimidin-6-yl]-N-[2-(dimethylamino)ethyl]benzamide |
|---|---|
| PubChem CID | 130241193 |
| Molecular Formula | C28H31N7O2S |
| Molecular Weight | 529.67 g/mol |
| Exact Mass | 529.23 |
| IUPAC Name | 3-[2-(3-amino-2-methanimidoylphenyl)-4-morpholin-4-ylthieno[3,2-d]pyrimidin-6-yl]-N-[2-(dimethylamino)ethyl]benzamide |
| SMILES | [H]/N=C/c1c(N)cccc1-c1nc(N2CCOCC2)c2sc(-c3cccc(C(=O)NCCN(C)C)c3)cc2n1 |
| InChI | InChI=1S/C28H31N7O2S/c1-34(2)10-9-31-28(36)19-6-3-5-18(15-19)24-16-23-25(38-24)27(35-11-13-37-14-12-35)33-26(32-23)20-7-4-8-22(30)21(20)17-29/h3-8,15-17,29H,9-14,30H2,1-2H3,(H,31,36)/b29-17+ |
| InChIKey | LJRMVXQVNIDUHW-STBIYBPSSA-N |
| XLogP | 3.73 |
| TPSA | 120.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.67 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|