C21H24N6O3S — CID 130241822
N-[[2-(3-amino-2-methanimidoylphenyl)-4-morpholin-4-ylthieno[3,2-d]pyrimidin-6-yl]methyl]-2-hydroxy-N-methylacetamide (PubChem CID 130241822) has the molecular formula C21H24N6O3S and a molecular weight of 440.53 g/mol. Its IUPAC name is N-[[2-(3-amino-2-methanimidoylphenyl)-4-morpholin-4-ylthieno[3,2-d]pyrimidin-6-yl]methyl]-2-hydroxy-N-methylacetamide.
| Compound Name | N-[[2-(3-amino-2-methanimidoylphenyl)-4-morpholin-4-ylthieno[3,2-d]pyrimidin-6-yl]methyl]-2-hydroxy-N-methylacetamide |
|---|---|
| PubChem CID | 130241822 |
| Molecular Formula | C21H24N6O3S |
| Molecular Weight | 440.53 g/mol |
| Exact Mass | 440.16 |
| IUPAC Name | N-[[2-(3-amino-2-methanimidoylphenyl)-4-morpholin-4-ylthieno[3,2-d]pyrimidin-6-yl]methyl]-2-hydroxy-N-methylacetamide |
| SMILES | [H]/N=C/c1c(N)cccc1-c1nc(N2CCOCC2)c2sc(CN(C)C(=O)CO)cc2n1 |
| InChI | InChI=1S/C21H24N6O3S/c1-26(18(29)12-28)11-13-9-17-19(31-13)21(27-5-7-30-8-6-27)25-20(24-17)14-3-2-4-16(23)15(14)10-22/h2-4,9-10,22,28H,5-8,11-12,23H2,1H3/b22-10+ |
| InChIKey | DDNBLXFWOKDKSC-LSHDLFTRSA-N |
| XLogP | 1.73 |
| TPSA | 128.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.53 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|