C21H22N4O3S — CID 58441410
N-[[2-(3-hydroxyphenyl)-4-morpholin-4-ylthieno[3,2-d]pyrimidin-6-yl]methyl]-N-methylprop-2-enamide (PubChem CID 58441410) has the molecular formula C21H22N4O3S and a molecular weight of 410.50 g/mol. Its IUPAC name is N-[[2-(3-hydroxyphenyl)-4-morpholin-4-ylthieno[3,2-d]pyrimidin-6-yl]methyl]-N-methylprop-2-enamide.
| Compound Name | N-[[2-(3-hydroxyphenyl)-4-morpholin-4-ylthieno[3,2-d]pyrimidin-6-yl]methyl]-N-methylprop-2-enamide |
|---|---|
| PubChem CID | 58441410 |
| Molecular Formula | C21H22N4O3S |
| Molecular Weight | 410.50 g/mol |
| Exact Mass | 410.14 |
| IUPAC Name | N-[[2-(3-hydroxyphenyl)-4-morpholin-4-ylthieno[3,2-d]pyrimidin-6-yl]methyl]-N-methylprop-2-enamide |
| SMILES | C=CC(=O)N(C)Cc1cc2nc(-c3cccc(O)c3)nc(N3CCOCC3)c2s1 |
| InChI | InChI=1S/C21H22N4O3S/c1-3-18(27)24(2)13-16-12-17-19(29-16)21(25-7-9-28-10-8-25)23-20(22-17)14-5-4-6-15(26)11-14/h3-6,11-12,26H,1,7-10,13H2,2H3 |
| InChIKey | YIMGVCAIXLSYKJ-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.50 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|