C25H27N5O3S — CID 123840079
1-[4-[3-[2-(3-hydroxyphenyl)-4-morpholin-4-ylthieno[3,2-d]pyrimidin-6-yl]prop-2-ynyl]piperazin-1-yl]ethanone (PubChem CID 123840079) has the molecular formula C25H27N5O3S and a molecular weight of 477.59 g/mol. Its IUPAC name is 1-[4-[3-[2-(3-hydroxyphenyl)-4-morpholin-4-ylthieno[3,2-d]pyrimidin-6-yl]prop-2-ynyl]piperazin-1-yl]ethanone.
| Compound Name | 1-[4-[3-[2-(3-hydroxyphenyl)-4-morpholin-4-ylthieno[3,2-d]pyrimidin-6-yl]prop-2-ynyl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 123840079 |
| Molecular Formula | C25H27N5O3S |
| Molecular Weight | 477.59 g/mol |
| Exact Mass | 477.18 |
| IUPAC Name | 1-[4-[3-[2-(3-hydroxyphenyl)-4-morpholin-4-ylthieno[3,2-d]pyrimidin-6-yl]prop-2-ynyl]piperazin-1-yl]ethanone |
| SMILES | CC(=O)N1CCN(CC#Cc2cc3nc(-c4cccc(O)c4)nc(N4CCOCC4)c3s2)CC1 |
| InChI | InChI=1S/C25H27N5O3S/c1-18(31)29-10-8-28(9-11-29)7-3-6-21-17-22-23(34-21)25(30-12-14-33-15-13-30)27-24(26-22)19-4-2-5-20(32)16-19/h2,4-5,16-17,32H,7-15H2,1H3 |
| InChIKey | GNAKVRJXXSGRNX-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 82.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.59 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|