C30H32N4O5S — CID 58441673
1-[4-hydroxy-4-[2-[2-(3-hydroxyphenyl)-4-morpholin-4-ylthieno[3,2-d]pyrimidin-6-yl]ethynyl]piperidin-1-yl]-5-methylhex-5-ene-1,4-dione (PubChem CID 58441673) has the molecular formula C30H32N4O5S and a molecular weight of 560.68 g/mol. Its IUPAC name is 1-[4-hydroxy-4-[2-[2-(3-hydroxyphenyl)-4-morpholin-4-ylthieno[3,2-d]pyrimidin-6-yl]ethynyl]piperidin-1-yl]-5-methylhex-5-ene-1,4-dione.
| Compound Name | 1-[4-hydroxy-4-[2-[2-(3-hydroxyphenyl)-4-morpholin-4-ylthieno[3,2-d]pyrimidin-6-yl]ethynyl]piperidin-1-yl]-5-methylhex-5-ene-1,4-dione |
|---|---|
| PubChem CID | 58441673 |
| Molecular Formula | C30H32N4O5S |
| Molecular Weight | 560.68 g/mol |
| Exact Mass | 560.21 |
| IUPAC Name | 1-[4-hydroxy-4-[2-[2-(3-hydroxyphenyl)-4-morpholin-4-ylthieno[3,2-d]pyrimidin-6-yl]ethynyl]piperidin-1-yl]-5-methylhex-5-ene-1,4-dione |
| SMILES | C=C(C)C(=O)CCC(=O)N1CCC(O)(C#Cc2cc3nc(-c4cccc(O)c4)nc(N4CCOCC4)c3s2)CC1 |
| InChI | InChI=1S/C30H32N4O5S/c1-20(2)25(36)6-7-26(37)33-12-10-30(38,11-13-33)9-8-23-19-24-27(40-23)29(34-14-16-39-17-15-34)32-28(31-24)21-4-3-5-22(35)18-21/h3-5,18-19,35,38H,1,6-7,10-17H2,2H3 |
| InChIKey | FPTMZSRLZSGAHQ-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 116.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.68 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|