C20H21N5O2S — CID 143572370
N-[[2-(2-methanimidoylphenyl)-4-morpholin-4-ylthieno[3,2-d]pyrimidin-6-yl]methyl]-N-methylformamide (PubChem CID 143572370) has the molecular formula C20H21N5O2S and a molecular weight of 395.49 g/mol. Its IUPAC name is N-[[2-(2-methanimidoylphenyl)-4-morpholin-4-ylthieno[3,2-d]pyrimidin-6-yl]methyl]-N-methylformamide.
| Compound Name | N-[[2-(2-methanimidoylphenyl)-4-morpholin-4-ylthieno[3,2-d]pyrimidin-6-yl]methyl]-N-methylformamide |
|---|---|
| PubChem CID | 143572370 |
| Molecular Formula | C20H21N5O2S |
| Molecular Weight | 395.49 g/mol |
| Exact Mass | 395.14 |
| IUPAC Name | N-[[2-(2-methanimidoylphenyl)-4-morpholin-4-ylthieno[3,2-d]pyrimidin-6-yl]methyl]-N-methylformamide |
| SMILES | [H]/N=C/c1ccccc1-c1nc(N2CCOCC2)c2sc(CN(C)C=O)cc2n1 |
| InChI | InChI=1S/C20H21N5O2S/c1-24(13-26)12-15-10-17-18(28-15)20(25-6-8-27-9-7-25)23-19(22-17)16-5-3-2-4-14(16)11-21/h2-5,10-11,13,21H,6-9,12H2,1H3/b21-11+ |
| InChIKey | DNMXUHDOBAZXCO-SRZZPIQSSA-N |
| XLogP | 2.78 |
| TPSA | 82.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.49 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|