C26H36N6OS — CID 137228885
4-[(E)-5-(4-ethylpiperazin-1-yl)pent-1-enyl]-2-(2-methanimidoylphenyl)-6-morpholin-4-ylpyrimidine-5-thiol (PubChem CID 137228885) has the molecular formula C26H36N6OS and a molecular weight of 480.68 g/mol. Its IUPAC name is 4-[(E)-5-(4-ethylpiperazin-1-yl)pent-1-enyl]-2-(2-methanimidoylphenyl)-6-morpholin-4-ylpyrimidine-5-thiol.
| Compound Name | 4-[(E)-5-(4-ethylpiperazin-1-yl)pent-1-enyl]-2-(2-methanimidoylphenyl)-6-morpholin-4-ylpyrimidine-5-thiol |
|---|---|
| PubChem CID | 137228885 |
| Molecular Formula | C26H36N6OS |
| Molecular Weight | 480.68 g/mol |
| Exact Mass | 480.27 |
| IUPAC Name | 4-[(E)-5-(4-ethylpiperazin-1-yl)pent-1-enyl]-2-(2-methanimidoylphenyl)-6-morpholin-4-ylpyrimidine-5-thiol |
| SMILES | [H]/N=C/c1ccccc1-c1nc(/C=C/CCCN2CCN(CC)CC2)c(S)c(N2CCOCC2)n1 |
| InChI | InChI=1S/C26H36N6OS/c1-2-30-12-14-31(15-13-30)11-7-3-4-10-23-24(34)26(32-16-18-33-19-17-32)29-25(28-23)22-9-6-5-8-21(22)20-27/h4-6,8-10,20,27,34H,2-3,7,11-19H2,1H3/b10-4+,27-20+ |
| InChIKey | YUBAXESNRYNHEA-PNBCYTJQSA-N |
| XLogP | 3.70 |
| TPSA | 68.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.68 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|