C28H36N7O2S+ — CID 143572242
[2-amino-6-[4-morpholin-4-yl-6-[[(4-morpholin-4-ylcyclohex-2-en-1-yl)amino]methyl]thieno[3,2-d]pyrimidin-2-yl]phenyl]methylideneazanium (PubChem CID 143572242) has the molecular formula C28H36N7O2S+ and a molecular weight of 534.71 g/mol. Its IUPAC name is [2-amino-6-[4-morpholin-4-yl-6-[[(4-morpholin-4-ylcyclohex-2-en-1-yl)amino]methyl]thieno[3,2-d]pyrimidin-2-yl]phenyl]methylideneazanium.
| Compound Name | [2-amino-6-[4-morpholin-4-yl-6-[[(4-morpholin-4-ylcyclohex-2-en-1-yl)amino]methyl]thieno[3,2-d]pyrimidin-2-yl]phenyl]methylideneazanium |
|---|---|
| PubChem CID | 143572242 |
| Molecular Formula | C28H36N7O2S+ |
| Molecular Weight | 534.71 g/mol |
| Exact Mass | 534.26 |
| IUPAC Name | [2-amino-6-[4-morpholin-4-yl-6-[[(4-morpholin-4-ylcyclohex-2-en-1-yl)amino]methyl]thieno[3,2-d]pyrimidin-2-yl]phenyl]methylideneazanium |
| SMILES | Nc1cccc(-c2nc(N3CCOCC3)c3sc(CNC4C=CC(N5CCOCC5)CC4)cc3n2)c1C=[NH2+] |
| InChI | InChI=1S/C28H35N7O2S/c29-17-23-22(2-1-3-24(23)30)27-32-25-16-21(38-26(25)28(33-27)35-10-14-37-15-11-35)18-31-19-4-6-20(7-5-19)34-8-12-36-13-9-34/h1-4,6,16-17,19-20,29,31H,5,7-15,18,30H2/p+1 |
| InChIKey | JCXQKMCJENQLBD-UHFFFAOYSA-O |
| XLogP | 1.46 |
| TPSA | 114.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.71 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|