C26H28N8O4S — CID 87223049
N-[[2-[4-(acetamidomethyl)phenyl]-4-morpholin-4-ylthieno[3,2-d]pyrimidin-6-yl]methyl-methylamino]-N-hydroxypyrimidine-5-carboxamide (PubChem CID 87223049) has the molecular formula C26H28N8O4S and a molecular weight of 548.63 g/mol. Its IUPAC name is N-[[2-[4-(acetamidomethyl)phenyl]-4-morpholin-4-ylthieno[3,2-d]pyrimidin-6-yl]methyl-methylamino]-N-hydroxypyrimidine-5-carboxamide.
| Compound Name | N-[[2-[4-(acetamidomethyl)phenyl]-4-morpholin-4-ylthieno[3,2-d]pyrimidin-6-yl]methyl-methylamino]-N-hydroxypyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 87223049 |
| Molecular Formula | C26H28N8O4S |
| Molecular Weight | 548.63 g/mol |
| Exact Mass | 548.20 |
| IUPAC Name | N-[[2-[4-(acetamidomethyl)phenyl]-4-morpholin-4-ylthieno[3,2-d]pyrimidin-6-yl]methyl-methylamino]-N-hydroxypyrimidine-5-carboxamide |
| SMILES | CC(=O)NCc1ccc(-c2nc(N3CCOCC3)c3sc(CN(C)N(O)C(=O)c4cncnc4)cc3n2)cc1 |
| InChI | InChI=1S/C26H28N8O4S/c1-17(35)29-12-18-3-5-19(6-4-18)24-30-22-11-21(39-23(22)25(31-24)33-7-9-38-10-8-33)15-32(2)34(37)26(36)20-13-27-16-28-14-20/h3-6,11,13-14,16,37H,7-10,12,15H2,1-2H3,(H,29,35) |
| InChIKey | RAMSOFDWGQTGJX-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 136.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.63 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|