C22H22N8O3S — CID 46841514
2-[[2-(4-aminophenyl)-4-morpholin-4-ylthieno[3,2-d]pyrimidin-6-yl]methylamino]-N-hydroxypyrimidine-5-carboxamide (PubChem CID 46841514) has the molecular formula C22H22N8O3S and a molecular weight of 478.54 g/mol. Its IUPAC name is 2-[[2-(4-aminophenyl)-4-morpholin-4-ylthieno[3,2-d]pyrimidin-6-yl]methylamino]-N-hydroxypyrimidine-5-carboxamide.
| Compound Name | 2-[[2-(4-aminophenyl)-4-morpholin-4-ylthieno[3,2-d]pyrimidin-6-yl]methylamino]-N-hydroxypyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 46841514 |
| Molecular Formula | C22H22N8O3S |
| Molecular Weight | 478.54 g/mol |
| Exact Mass | 478.15 |
| IUPAC Name | 2-[[2-(4-aminophenyl)-4-morpholin-4-ylthieno[3,2-d]pyrimidin-6-yl]methylamino]-N-hydroxypyrimidine-5-carboxamide |
| SMILES | Nc1ccc(-c2nc(N3CCOCC3)c3sc(CNc4ncc(C(=O)NO)cn4)cc3n2)cc1 |
| InChI | InChI=1S/C22H22N8O3S/c23-15-3-1-13(2-4-15)19-27-17-9-16(12-26-22-24-10-14(11-25-22)21(31)29-32)34-18(17)20(28-19)30-5-7-33-8-6-30/h1-4,9-11,32H,5-8,12,23H2,(H,29,31)(H,24,25,26) |
| InChIKey | WXPNAPRTMLYJSK-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 151.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.54 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|