C25H26FN7O4S — CID 87406336
2-[[2-[2-fluoro-5-(2-hydroxyethyl)phenyl]-4-morpholin-4-ylthieno[3,2-d]pyrimidin-6-yl]methyl-methylamino]-N-hydroxypyrimidine-5-carboxamide (PubChem CID 87406336) has the molecular formula C25H26FN7O4S and a molecular weight of 539.59 g/mol. Its IUPAC name is 2-[[2-[2-fluoro-5-(2-hydroxyethyl)phenyl]-4-morpholin-4-ylthieno[3,2-d]pyrimidin-6-yl]methyl-methylamino]-N-hydroxypyrimidine-5-carboxamide.
| Compound Name | 2-[[2-[2-fluoro-5-(2-hydroxyethyl)phenyl]-4-morpholin-4-ylthieno[3,2-d]pyrimidin-6-yl]methyl-methylamino]-N-hydroxypyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 87406336 |
| Molecular Formula | C25H26FN7O4S |
| Molecular Weight | 539.59 g/mol |
| Exact Mass | 539.18 |
| IUPAC Name | 2-[[2-[2-fluoro-5-(2-hydroxyethyl)phenyl]-4-morpholin-4-ylthieno[3,2-d]pyrimidin-6-yl]methyl-methylamino]-N-hydroxypyrimidine-5-carboxamide |
| SMILES | CN(Cc1cc2nc(-c3cc(CCO)ccc3F)nc(N3CCOCC3)c2s1)c1ncc(C(=O)NO)cn1 |
| InChI | InChI=1S/C25H26FN7O4S/c1-32(25-27-12-16(13-28-25)24(35)31-36)14-17-11-20-21(38-17)23(33-5-8-37-9-6-33)30-22(29-20)18-10-15(4-7-34)2-3-19(18)26/h2-3,10-13,34,36H,4-9,14H2,1H3,(H,31,35) |
| InChIKey | JRXRBFJHCQXJPZ-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 136.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.59 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|