C25H25FN8O4S — CID 123490881
2-[[2-[2-fluoro-5-(N-hydroxy-C-methylcarbonimidoyl)phenyl]-4-morpholin-4-ylthieno[3,2-d]pyrimidin-6-yl]methyl-methylamino]-N-hydroxypyrimidine-5-carboxamide (PubChem CID 123490881) has the molecular formula C25H25FN8O4S and a molecular weight of 552.59 g/mol. Its IUPAC name is 2-[[2-[2-fluoro-5-(N-hydroxy-C-methylcarbonimidoyl)phenyl]-4-morpholin-4-ylthieno[3,2-d]pyrimidin-6-yl]methyl-methylamino]-N-hydroxypyrimidine-5-carboxamide.
| Compound Name | 2-[[2-[2-fluoro-5-(N-hydroxy-C-methylcarbonimidoyl)phenyl]-4-morpholin-4-ylthieno[3,2-d]pyrimidin-6-yl]methyl-methylamino]-N-hydroxypyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 123490881 |
| Molecular Formula | C25H25FN8O4S |
| Molecular Weight | 552.59 g/mol |
| Exact Mass | 552.17 |
| IUPAC Name | 2-[[2-[2-fluoro-5-(N-hydroxy-C-methylcarbonimidoyl)phenyl]-4-morpholin-4-ylthieno[3,2-d]pyrimidin-6-yl]methyl-methylamino]-N-hydroxypyrimidine-5-carboxamide |
| SMILES | CC(=NO)c1ccc(F)c(-c2nc(N3CCOCC3)c3sc(CN(C)c4ncc(C(=O)NO)cn4)cc3n2)c1 |
| InChI | InChI=1S/C25H25FN8O4S/c1-14(31-36)15-3-4-19(26)18(9-15)22-29-20-10-17(39-21(20)23(30-22)34-5-7-38-8-6-34)13-33(2)25-27-11-16(12-28-25)24(35)32-37/h3-4,9-12,36-37H,5-8,13H2,1-2H3,(H,32,35) |
| InChIKey | FVMJMVOCZVUOMW-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 149.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.59 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|