C27H32N10O3 — CID 118374622
(E)-3-[4-[[[2-(2-aminopyrimidin-5-yl)-9-ethyl-6-morpholin-4-ylpurin-8-yl]methyl-methylamino]methyl]phenyl]-N-hydroxyprop-2-enamide (PubChem CID 118374622) has the molecular formula C27H32N10O3 and a molecular weight of 544.62 g/mol. Its IUPAC name is (E)-3-[4-[[[2-(2-aminopyrimidin-5-yl)-9-ethyl-6-morpholin-4-ylpurin-8-yl]methyl-methylamino]methyl]phenyl]-N-hydroxyprop-2-enamide.
| Compound Name | (E)-3-[4-[[[2-(2-aminopyrimidin-5-yl)-9-ethyl-6-morpholin-4-ylpurin-8-yl]methyl-methylamino]methyl]phenyl]-N-hydroxyprop-2-enamide |
|---|---|
| PubChem CID | 118374622 |
| Molecular Formula | C27H32N10O3 |
| Molecular Weight | 544.62 g/mol |
| Exact Mass | 544.27 |
| IUPAC Name | (E)-3-[4-[[[2-(2-aminopyrimidin-5-yl)-9-ethyl-6-morpholin-4-ylpurin-8-yl]methyl-methylamino]methyl]phenyl]-N-hydroxyprop-2-enamide |
| SMILES | CCn1c(CN(C)Cc2ccc(/C=C/C(=O)NO)cc2)nc2c(N3CCOCC3)nc(-c3cnc(N)nc3)nc21 |
| InChI | InChI=1S/C27H32N10O3/c1-3-37-21(17-35(2)16-19-6-4-18(5-7-19)8-9-22(38)34-39)31-23-25(36-10-12-40-13-11-36)32-24(33-26(23)37)20-14-29-27(28)30-15-20/h4-9,14-15,39H,3,10-13,16-17H2,1-2H3,(H,34,38)(H2,28,29,30)/b9-8+ |
| InChIKey | MEBSEKQEBSTPFO-CMDGGOBGSA-N |
| XLogP | 1.87 |
| TPSA | 160.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.62 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|