C23H29N11O3 — CID 145172477
(E)-N-hydroxy-3-(methylideneamino)-2-[(Z)-[methyl-[[9-methyl-2-(2-methylpyrimidin-5-yl)-6-morpholin-4-ylpurin-8-yl]methyl]amino]methyliminomethyl]prop-2-enamide (PubChem CID 145172477) has the molecular formula C23H29N11O3 and a molecular weight of 507.56 g/mol. Its IUPAC name is (E)-N-hydroxy-3-(methylideneamino)-2-[(Z)-[methyl-[[9-methyl-2-(2-methylpyrimidin-5-yl)-6-morpholin-4-ylpurin-8-yl]methyl]amino]methyliminomethyl]prop-2-enamide.
| Compound Name | (E)-N-hydroxy-3-(methylideneamino)-2-[(Z)-[methyl-[[9-methyl-2-(2-methylpyrimidin-5-yl)-6-morpholin-4-ylpurin-8-yl]methyl]amino]methyliminomethyl]prop-2-enamide |
|---|---|
| PubChem CID | 145172477 |
| Molecular Formula | C23H29N11O3 |
| Molecular Weight | 507.56 g/mol |
| Exact Mass | 507.25 |
| IUPAC Name | (E)-N-hydroxy-3-(methylideneamino)-2-[(Z)-[methyl-[[9-methyl-2-(2-methylpyrimidin-5-yl)-6-morpholin-4-ylpurin-8-yl]methyl]amino]methyliminomethyl]prop-2-enamide |
| SMILES | C=N/C=C(\C=N/CN(C)Cc1nc2c(N3CCOCC3)nc(-c3cnc(C)nc3)nc2n1C)C(=O)NO |
| InChI | InChI=1S/C23H29N11O3/c1-15-26-11-16(12-27-15)20-29-21-19(22(30-20)34-5-7-37-8-6-34)28-18(33(21)4)13-32(3)14-25-10-17(9-24-2)23(35)31-36/h9-12,36H,2,5-8,13-14H2,1,3-4H3,(H,31,35)/b17-9+,25-10- |
| InChIKey | HFTOIUARSDMQIY-NBHKAPIESA-N |
| XLogP | 0.52 |
| TPSA | 159.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.56 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|