C25H34N8O3S — CID 145172401
(E)-2-[2-[[2-(5-butylthiophen-2-yl)-5-(methylideneamino)-6-morpholin-4-ylpyrimidin-4-yl]-methylamino]ethyliminomethyl]-N-hydroxy-3-(methylideneamino)prop-2-enamide (PubChem CID 145172401) has the molecular formula C25H34N8O3S and a molecular weight of 526.67 g/mol. Its IUPAC name is (E)-2-[2-[[2-(5-butylthiophen-2-yl)-5-(methylideneamino)-6-morpholin-4-ylpyrimidin-4-yl]-methylamino]ethyliminomethyl]-N-hydroxy-3-(methylideneamino)prop-2-enamide.
| Compound Name | (E)-2-[2-[[2-(5-butylthiophen-2-yl)-5-(methylideneamino)-6-morpholin-4-ylpyrimidin-4-yl]-methylamino]ethyliminomethyl]-N-hydroxy-3-(methylideneamino)prop-2-enamide |
|---|---|
| PubChem CID | 145172401 |
| Molecular Formula | C25H34N8O3S |
| Molecular Weight | 526.67 g/mol |
| Exact Mass | 526.25 |
| IUPAC Name | (E)-2-[2-[[2-(5-butylthiophen-2-yl)-5-(methylideneamino)-6-morpholin-4-ylpyrimidin-4-yl]-methylamino]ethyliminomethyl]-N-hydroxy-3-(methylideneamino)prop-2-enamide |
| SMILES | C=N/C=C(\C=N\CCN(C)c1nc(-c2ccc(CCCC)s2)nc(N2CCOCC2)c1N=C)C(=O)NO |
| InChI | InChI=1S/C25H34N8O3S/c1-5-6-7-19-8-9-20(37-19)22-29-23(21(27-3)24(30-22)33-12-14-36-15-13-33)32(4)11-10-28-17-18(16-26-2)25(34)31-35/h8-9,16-17,35H,2-3,5-7,10-15H2,1,4H3,(H,31,34)/b18-16+,28-17+ |
| InChIKey | LRIBXXUHGXGRMO-SESODYGISA-N |
| XLogP | 3.31 |
| TPSA | 127.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.67 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|