C29H40N10O2 — CID 145172451
(E)-2-[(Z)-[2-[[2-(4-amino-3-methanimidoylphenyl)-5-(methylideneamino)-6-morpholin-4-ylpyrimidin-4-yl]-methylamino]ethyl-butylamino]methyliminomethyl]-3-(methylideneamino)prop-2-enal (PubChem CID 145172451) has the molecular formula C29H40N10O2 and a molecular weight of 560.71 g/mol. Its IUPAC name is (E)-2-[(Z)-[2-[[2-(4-amino-3-methanimidoylphenyl)-5-(methylideneamino)-6-morpholin-4-ylpyrimidin-4-yl]-methylamino]ethyl-butylamino]methyliminomethyl]-3-(methylideneamino)prop-2-enal.
| Compound Name | (E)-2-[(Z)-[2-[[2-(4-amino-3-methanimidoylphenyl)-5-(methylideneamino)-6-morpholin-4-ylpyrimidin-4-yl]-methylamino]ethyl-butylamino]methyliminomethyl]-3-(methylideneamino)prop-2-enal |
|---|---|
| PubChem CID | 145172451 |
| Molecular Formula | C29H40N10O2 |
| Molecular Weight | 560.71 g/mol |
| Exact Mass | 560.33 |
| IUPAC Name | (E)-2-[(Z)-[2-[[2-(4-amino-3-methanimidoylphenyl)-5-(methylideneamino)-6-morpholin-4-ylpyrimidin-4-yl]-methylamino]ethyl-butylamino]methyliminomethyl]-3-(methylideneamino)prop-2-enal |
| SMILES | [H]/N=C/c1cc(-c2nc(N(C)CCN(CCCC)C/N=C\C(C=O)=C/N=C)c(N=C)c(N3CCOCC3)n2)ccc1N |
| InChI | InChI=1S/C29H40N10O2/c1-5-6-9-38(21-34-19-22(20-40)18-32-2)11-10-37(4)28-26(33-3)29(39-12-14-41-15-13-39)36-27(35-28)23-7-8-25(31)24(16-23)17-30/h7-8,16-20,30H,2-3,5-6,9-15,21,31H2,1,4H3/b22-18+,30-17+,34-19- |
| InChIKey | BRUIRXZONUXINA-DSIVDAODSA-N |
| XLogP | 3.24 |
| TPSA | 148.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.71 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|