C27H33N11O3 — CID 149112362
2-[[2-(4-amino-3-methanimidoylphenyl)-9-methyl-6-morpholin-4-ylpurin-8-yl]methyl-butylamino]-N-hydroxypyrimidine-5-carboxamide (PubChem CID 149112362) has the molecular formula C27H33N11O3 and a molecular weight of 559.64 g/mol. Its IUPAC name is 2-[[2-(4-amino-3-methanimidoylphenyl)-9-methyl-6-morpholin-4-ylpurin-8-yl]methyl-butylamino]-N-hydroxypyrimidine-5-carboxamide.
| Compound Name | 2-[[2-(4-amino-3-methanimidoylphenyl)-9-methyl-6-morpholin-4-ylpurin-8-yl]methyl-butylamino]-N-hydroxypyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 149112362 |
| Molecular Formula | C27H33N11O3 |
| Molecular Weight | 559.64 g/mol |
| Exact Mass | 559.28 |
| IUPAC Name | 2-[[2-(4-amino-3-methanimidoylphenyl)-9-methyl-6-morpholin-4-ylpurin-8-yl]methyl-butylamino]-N-hydroxypyrimidine-5-carboxamide |
| SMILES | [H]/N=C/c1cc(-c2nc(N3CCOCC3)c3nc(CN(CCCC)c4ncc(C(=O)NO)cn4)n(C)c3n2)ccc1N |
| InChI | InChI=1S/C27H33N11O3/c1-3-4-7-38(27-30-14-19(15-31-27)26(39)35-40)16-21-32-22-24(36(21)2)33-23(17-5-6-20(29)18(12-17)13-28)34-25(22)37-8-10-41-11-9-37/h5-6,12-15,28,40H,3-4,7-11,16,29H2,1-2H3,(H,35,39)/b28-13+ |
| InChIKey | QXMXDNSPZCAVKQ-XODNFHPESA-N |
| XLogP | 2.16 |
| TPSA | 184.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.64 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|