C27H36N10O4 — CID 145172448
ethane;N-hydroxy-2-[[2-(6-methoxy-3-pyridinyl)-6-morpholin-4-yl-9-propan-2-ylpurin-8-yl]methyl-methylamino]pyrimidine-5-carboxamide (PubChem CID 145172448) has the molecular formula C27H36N10O4 and a molecular weight of 564.65 g/mol. Its IUPAC name is ethane;N-hydroxy-2-[[2-(6-methoxy-3-pyridinyl)-6-morpholin-4-yl-9-propan-2-ylpurin-8-yl]methyl-methylamino]pyrimidine-5-carboxamide.
| Compound Name | ethane;N-hydroxy-2-[[2-(6-methoxy-3-pyridinyl)-6-morpholin-4-yl-9-propan-2-ylpurin-8-yl]methyl-methylamino]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 145172448 |
| Molecular Formula | C27H36N10O4 |
| Molecular Weight | 564.65 g/mol |
| Exact Mass | 564.29 |
| IUPAC Name | ethane;N-hydroxy-2-[[2-(6-methoxy-3-pyridinyl)-6-morpholin-4-yl-9-propan-2-ylpurin-8-yl]methyl-methylamino]pyrimidine-5-carboxamide |
| SMILES | CC.COc1ccc(-c2nc(N3CCOCC3)c3nc(CN(C)c4ncc(C(=O)NO)cn4)n(C(C)C)c3n2)cn1 |
| InChI | InChI=1S/C25H30N10O4.C2H6/c1-15(2)35-18(14-33(3)25-27-12-17(13-28-25)24(36)32-37)29-20-22(34-7-9-39-10-8-34)30-21(31-23(20)35)16-5-6-19(38-4)26-11-16;1-2/h5-6,11-13,15,37H,7-10,14H2,1-4H3,(H,32,36);1-2H3 |
| InChIKey | QYQGIBFCYCPPKS-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 156.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.65 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|