C24H32N12O3 — CID 122648342
2-[[2-[1-[2-(dimethylamino)ethyl]pyrazol-4-yl]-9-methyl-6-morpholin-4-ylpurin-8-yl]methyl-methylamino]-N-hydroxypyrimidine-5-carboxamide (PubChem CID 122648342) has the molecular formula C24H32N12O3 and a molecular weight of 536.60 g/mol. Its IUPAC name is 2-[[2-[1-[2-(dimethylamino)ethyl]pyrazol-4-yl]-9-methyl-6-morpholin-4-ylpurin-8-yl]methyl-methylamino]-N-hydroxypyrimidine-5-carboxamide.
| Compound Name | 2-[[2-[1-[2-(dimethylamino)ethyl]pyrazol-4-yl]-9-methyl-6-morpholin-4-ylpurin-8-yl]methyl-methylamino]-N-hydroxypyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 122648342 |
| Molecular Formula | C24H32N12O3 |
| Molecular Weight | 536.60 g/mol |
| Exact Mass | 536.27 |
| IUPAC Name | 2-[[2-[1-[2-(dimethylamino)ethyl]pyrazol-4-yl]-9-methyl-6-morpholin-4-ylpurin-8-yl]methyl-methylamino]-N-hydroxypyrimidine-5-carboxamide |
| SMILES | CN(C)CCn1cc(-c2nc(N3CCOCC3)c3nc(CN(C)c4ncc(C(=O)NO)cn4)n(C)c3n2)cn1 |
| InChI | InChI=1S/C24H32N12O3/c1-32(2)5-6-36-14-17(13-27-36)20-29-21-19(22(30-20)35-7-9-39-10-8-35)28-18(34(21)4)15-33(3)24-25-11-16(12-26-24)23(37)31-38/h11-14,38H,5-10,15H2,1-4H3,(H,31,37) |
| InChIKey | GAOUSKOEJQWNGF-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 155.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.60 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|