C22H23N9O2 — CID 134288227
2-[methyl-[(9-methyl-6-morpholin-4-yl-2-pyridin-3-ylpurin-8-yl)methyl]amino]pyrimidine-5-carbaldehyde (PubChem CID 134288227) has the molecular formula C22H23N9O2 and a molecular weight of 445.49 g/mol. Its IUPAC name is 2-[methyl-[(9-methyl-6-morpholin-4-yl-2-pyridin-3-ylpurin-8-yl)methyl]amino]pyrimidine-5-carbaldehyde.
| Compound Name | 2-[methyl-[(9-methyl-6-morpholin-4-yl-2-pyridin-3-ylpurin-8-yl)methyl]amino]pyrimidine-5-carbaldehyde |
|---|---|
| PubChem CID | 134288227 |
| Molecular Formula | C22H23N9O2 |
| Molecular Weight | 445.49 g/mol |
| Exact Mass | 445.20 |
| IUPAC Name | 2-[methyl-[(9-methyl-6-morpholin-4-yl-2-pyridin-3-ylpurin-8-yl)methyl]amino]pyrimidine-5-carbaldehyde |
| SMILES | CN(Cc1nc2c(N3CCOCC3)nc(-c3cccnc3)nc2n1C)c1ncc(C=O)cn1 |
| InChI | InChI=1S/C22H23N9O2/c1-29(22-24-10-15(14-32)11-25-22)13-17-26-18-20(30(17)2)27-19(16-4-3-5-23-12-16)28-21(18)31-6-8-33-9-7-31/h3-5,10-12,14H,6-9,13H2,1-2H3 |
| InChIKey | JBGFYWASGPOTCC-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 115.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.49 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|