C26H30N8O2 — CID 134288234
2-[methyl-[[9-methyl-6-morpholin-4-yl-2-(4-propylphenyl)purin-8-yl]methyl]amino]pyrimidine-5-carbaldehyde (PubChem CID 134288234) has the molecular formula C26H30N8O2 and a molecular weight of 486.58 g/mol. Its IUPAC name is 2-[methyl-[[9-methyl-6-morpholin-4-yl-2-(4-propylphenyl)purin-8-yl]methyl]amino]pyrimidine-5-carbaldehyde.
| Compound Name | 2-[methyl-[[9-methyl-6-morpholin-4-yl-2-(4-propylphenyl)purin-8-yl]methyl]amino]pyrimidine-5-carbaldehyde |
|---|---|
| PubChem CID | 134288234 |
| Molecular Formula | C26H30N8O2 |
| Molecular Weight | 486.58 g/mol |
| Exact Mass | 486.25 |
| IUPAC Name | 2-[methyl-[[9-methyl-6-morpholin-4-yl-2-(4-propylphenyl)purin-8-yl]methyl]amino]pyrimidine-5-carbaldehyde |
| SMILES | CCCc1ccc(-c2nc(N3CCOCC3)c3nc(CN(C)c4ncc(C=O)cn4)n(C)c3n2)cc1 |
| InChI | InChI=1S/C26H30N8O2/c1-4-5-18-6-8-20(9-7-18)23-30-24-22(25(31-23)34-10-12-36-13-11-34)29-21(33(24)3)16-32(2)26-27-14-19(17-35)15-28-26/h6-9,14-15,17H,4-5,10-13,16H2,1-3H3 |
| InChIKey | HZCJYBGBOTVMOR-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 102.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.58 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|