C26H31N7O3 — CID 123207522
2-[3-[4-(4-amino-3-methanimidoylanilino)-6-morpholin-4-ylpyrimidin-2-yl]phenoxy]-N-propan-2-ylacetamide (PubChem CID 123207522) has the molecular formula C26H31N7O3 and a molecular weight of 489.58 g/mol. Its IUPAC name is 2-[3-[4-(4-amino-3-methanimidoylanilino)-6-morpholin-4-ylpyrimidin-2-yl]phenoxy]-N-propan-2-ylacetamide.
| Compound Name | 2-[3-[4-(4-amino-3-methanimidoylanilino)-6-morpholin-4-ylpyrimidin-2-yl]phenoxy]-N-propan-2-ylacetamide |
|---|---|
| PubChem CID | 123207522 |
| Molecular Formula | C26H31N7O3 |
| Molecular Weight | 489.58 g/mol |
| Exact Mass | 489.25 |
| IUPAC Name | 2-[3-[4-(4-amino-3-methanimidoylanilino)-6-morpholin-4-ylpyrimidin-2-yl]phenoxy]-N-propan-2-ylacetamide |
| SMILES | [H]/N=C/c1cc(Nc2cc(N3CCOCC3)nc(-c3cccc(OCC(=O)NC(C)C)c3)n2)ccc1N |
| InChI | InChI=1S/C26H31N7O3/c1-17(2)29-25(34)16-36-21-5-3-4-18(13-21)26-31-23(14-24(32-26)33-8-10-35-11-9-33)30-20-6-7-22(28)19(12-20)15-27/h3-7,12-15,17,27H,8-11,16,28H2,1-2H3,(H,29,34)(H,30,31,32)/b27-15+ |
| InChIKey | GODARWAPUPXJEY-JFLMPSFJSA-N |
| XLogP | 3.21 |
| TPSA | 138.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.58 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|