C27H36N8O2 — CID 144945034
2-[3-[4-(4-amino-3-methanimidoylanilino)-6-[2-(dimethylamino)ethyl-methylamino]pyrimidin-2-yl]phenoxy]-N-propan-2-ylacetamide (PubChem CID 144945034) has the molecular formula C27H36N8O2 and a molecular weight of 504.64 g/mol. Its IUPAC name is 2-[3-[4-(4-amino-3-methanimidoylanilino)-6-[2-(dimethylamino)ethyl-methylamino]pyrimidin-2-yl]phenoxy]-N-propan-2-ylacetamide.
| Compound Name | 2-[3-[4-(4-amino-3-methanimidoylanilino)-6-[2-(dimethylamino)ethyl-methylamino]pyrimidin-2-yl]phenoxy]-N-propan-2-ylacetamide |
|---|---|
| PubChem CID | 144945034 |
| Molecular Formula | C27H36N8O2 |
| Molecular Weight | 504.64 g/mol |
| Exact Mass | 504.30 |
| IUPAC Name | 2-[3-[4-(4-amino-3-methanimidoylanilino)-6-[2-(dimethylamino)ethyl-methylamino]pyrimidin-2-yl]phenoxy]-N-propan-2-ylacetamide |
| SMILES | [H]/N=C/c1cc(Nc2cc(N(C)CCN(C)C)nc(-c3cccc(OCC(=O)NC(C)C)c3)n2)ccc1N |
| InChI | InChI=1S/C27H36N8O2/c1-18(2)30-26(36)17-37-22-8-6-7-19(14-22)27-32-24(15-25(33-27)35(5)12-11-34(3)4)31-21-9-10-23(29)20(13-21)16-28/h6-10,13-16,18,28H,11-12,17,29H2,1-5H3,(H,30,36)(H,31,32,33)/b28-16+ |
| InChIKey | SQRKWGHSEJEXLK-LQKURTRISA-N |
| XLogP | 3.37 |
| TPSA | 132.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.64 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|