C23H22N4O3S — CID 151789083
2-[3-[4-(4-hydroxyanilino)thieno[3,2-d]pyrimidin-2-yl]phenoxy]-N-propan-2-ylacetamide (PubChem CID 151789083) has the molecular formula C23H22N4O3S and a molecular weight of 434.52 g/mol. Its IUPAC name is 2-[3-[4-(4-hydroxyanilino)thieno[3,2-d]pyrimidin-2-yl]phenoxy]-N-propan-2-ylacetamide.
| Compound Name | 2-[3-[4-(4-hydroxyanilino)thieno[3,2-d]pyrimidin-2-yl]phenoxy]-N-propan-2-ylacetamide |
|---|---|
| PubChem CID | 151789083 |
| Molecular Formula | C23H22N4O3S |
| Molecular Weight | 434.52 g/mol |
| Exact Mass | 434.14 |
| IUPAC Name | 2-[3-[4-(4-hydroxyanilino)thieno[3,2-d]pyrimidin-2-yl]phenoxy]-N-propan-2-ylacetamide |
| SMILES | CC(C)NC(=O)COc1cccc(-c2nc(Nc3ccc(O)cc3)c3sccc3n2)c1 |
| InChI | InChI=1S/C23H22N4O3S/c1-14(2)24-20(29)13-30-18-5-3-4-15(12-18)22-26-19-10-11-31-21(19)23(27-22)25-16-6-8-17(28)9-7-16/h3-12,14,28H,13H2,1-2H3,(H,24,29)(H,25,26,27) |
| InChIKey | RWFWAXVARGTZPF-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 96.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.52 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|