C23H19N5O2S — CID 163431850
2-[3-[4-[4-(3-iminoprop-1-en-2-yl)anilino]thieno[3,2-d]pyrimidin-2-yl]phenoxy]acetamide (PubChem CID 163431850) has the molecular formula C23H19N5O2S and a molecular weight of 429.51 g/mol. Its IUPAC name is 2-[3-[4-[4-(3-iminoprop-1-en-2-yl)anilino]thieno[3,2-d]pyrimidin-2-yl]phenoxy]acetamide.
| Compound Name | 2-[3-[4-[4-(3-iminoprop-1-en-2-yl)anilino]thieno[3,2-d]pyrimidin-2-yl]phenoxy]acetamide |
|---|---|
| PubChem CID | 163431850 |
| Molecular Formula | C23H19N5O2S |
| Molecular Weight | 429.51 g/mol |
| Exact Mass | 429.13 |
| IUPAC Name | 2-[3-[4-[4-(3-iminoprop-1-en-2-yl)anilino]thieno[3,2-d]pyrimidin-2-yl]phenoxy]acetamide |
| SMILES | [H]/N=C/C(=C)c1ccc(Nc2nc(-c3cccc(OCC(N)=O)c3)nc3ccsc23)cc1 |
| InChI | InChI=1S/C23H19N5O2S/c1-14(12-24)15-5-7-17(8-6-15)26-23-21-19(9-10-31-21)27-22(28-23)16-3-2-4-18(11-16)30-13-20(25)29/h2-12,24H,1,13H2,(H2,25,29)(H,26,27,28)/b24-12+ |
| InChIKey | ARELTBKXURZYNO-WYMPLXKRSA-N |
| XLogP | 4.63 |
| TPSA | 113.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.51 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|