C31H41N7O2 — CID 123151554
2-[3-[4-(4-amino-3-methanimidoylanilino)-6-(4-propylazepan-1-yl)pyrimidin-2-yl]phenoxy]-N-propan-2-ylacetamide (PubChem CID 123151554) has the molecular formula C31H41N7O2 and a molecular weight of 543.72 g/mol. Its IUPAC name is 2-[3-[4-(4-amino-3-methanimidoylanilino)-6-(4-propylazepan-1-yl)pyrimidin-2-yl]phenoxy]-N-propan-2-ylacetamide.
| Compound Name | 2-[3-[4-(4-amino-3-methanimidoylanilino)-6-(4-propylazepan-1-yl)pyrimidin-2-yl]phenoxy]-N-propan-2-ylacetamide |
|---|---|
| PubChem CID | 123151554 |
| Molecular Formula | C31H41N7O2 |
| Molecular Weight | 543.72 g/mol |
| Exact Mass | 543.33 |
| IUPAC Name | 2-[3-[4-(4-amino-3-methanimidoylanilino)-6-(4-propylazepan-1-yl)pyrimidin-2-yl]phenoxy]-N-propan-2-ylacetamide |
| SMILES | [H]/N=C/c1cc(Nc2cc(N3CCCC(CCC)CC3)nc(-c3cccc(OCC(=O)NC(C)C)c3)n2)ccc1N |
| InChI | InChI=1S/C31H41N7O2/c1-4-7-22-8-6-14-38(15-13-22)29-18-28(35-25-11-12-27(33)24(16-25)19-32)36-31(37-29)23-9-5-10-26(17-23)40-20-30(39)34-21(2)3/h5,9-12,16-19,21-22,32H,4,6-8,13-15,20,33H2,1-3H3,(H,34,39)(H,35,36,37)/b32-19+ |
| InChIKey | PXKOSCOHOLJZDQ-BIZUNTBRSA-N |
| XLogP | 5.78 |
| TPSA | 129.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.72 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|