C22H21F3N6O2 — CID 162561383
2-methanimidoyl-4-N-[2-morpholin-4-yl-6-[3-(trifluoromethoxy)phenyl]pyrimidin-4-yl]benzene-1,4-diamine (PubChem CID 162561383) has the molecular formula C22H21F3N6O2 and a molecular weight of 458.44 g/mol. Its IUPAC name is 2-methanimidoyl-4-N-[2-morpholin-4-yl-6-[3-(trifluoromethoxy)phenyl]pyrimidin-4-yl]benzene-1,4-diamine.
| Compound Name | 2-methanimidoyl-4-N-[2-morpholin-4-yl-6-[3-(trifluoromethoxy)phenyl]pyrimidin-4-yl]benzene-1,4-diamine |
|---|---|
| PubChem CID | 162561383 |
| Molecular Formula | C22H21F3N6O2 |
| Molecular Weight | 458.44 g/mol |
| Exact Mass | 458.17 |
| IUPAC Name | 2-methanimidoyl-4-N-[2-morpholin-4-yl-6-[3-(trifluoromethoxy)phenyl]pyrimidin-4-yl]benzene-1,4-diamine |
| SMILES | [H]/N=C/c1cc(Nc2cc(-c3cccc(OC(F)(F)F)c3)nc(N3CCOCC3)n2)ccc1N |
| InChI | InChI=1S/C22H21F3N6O2/c23-22(24,25)33-17-3-1-2-14(11-17)19-12-20(28-16-4-5-18(27)15(10-16)13-26)30-21(29-19)31-6-8-32-9-7-31/h1-5,10-13,26H,6-9,27H2,(H,28,29,30)/b26-13+ |
| InChIKey | VBGLATOVJHTXIH-LGJNPRDNSA-N |
| XLogP | 4.20 |
| TPSA | 109.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.44 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|