C23H21F3N4O3 — CID 87792851
2-[3-[2-morpholin-4-yl-6-[4-(trifluoromethoxy)anilino]pyrimidin-4-yl]phenyl]acetaldehyde (PubChem CID 87792851) has the molecular formula C23H21F3N4O3 and a molecular weight of 458.44 g/mol. Its IUPAC name is 2-[3-[2-morpholin-4-yl-6-[4-(trifluoromethoxy)anilino]pyrimidin-4-yl]phenyl]acetaldehyde.
| Compound Name | 2-[3-[2-morpholin-4-yl-6-[4-(trifluoromethoxy)anilino]pyrimidin-4-yl]phenyl]acetaldehyde |
|---|---|
| PubChem CID | 87792851 |
| Molecular Formula | C23H21F3N4O3 |
| Molecular Weight | 458.44 g/mol |
| Exact Mass | 458.16 |
| IUPAC Name | 2-[3-[2-morpholin-4-yl-6-[4-(trifluoromethoxy)anilino]pyrimidin-4-yl]phenyl]acetaldehyde |
| SMILES | O=CCc1cccc(-c2cc(Nc3ccc(OC(F)(F)F)cc3)nc(N3CCOCC3)n2)c1 |
| InChI | InChI=1S/C23H21F3N4O3/c24-23(25,26)33-19-6-4-18(5-7-19)27-21-15-20(17-3-1-2-16(14-17)8-11-31)28-22(29-21)30-9-12-32-13-10-30/h1-7,11,14-15H,8-10,12-13H2,(H,27,28,29) |
| InChIKey | KEHGGQHPUNLTHP-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.44 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|