C21H21ClN6O — CID 145062178
6-(3-amino-4-methanimidoylphenyl)-N-(4-chlorophenyl)-2-morpholin-4-ylpyrimidin-4-amine (PubChem CID 145062178) has the molecular formula C21H21ClN6O and a molecular weight of 408.89 g/mol. Its IUPAC name is 6-(3-amino-4-methanimidoylphenyl)-N-(4-chlorophenyl)-2-morpholin-4-ylpyrimidin-4-amine.
| Compound Name | 6-(3-amino-4-methanimidoylphenyl)-N-(4-chlorophenyl)-2-morpholin-4-ylpyrimidin-4-amine |
|---|---|
| PubChem CID | 145062178 |
| Molecular Formula | C21H21ClN6O |
| Molecular Weight | 408.89 g/mol |
| Exact Mass | 408.15 |
| IUPAC Name | 6-(3-amino-4-methanimidoylphenyl)-N-(4-chlorophenyl)-2-morpholin-4-ylpyrimidin-4-amine |
| SMILES | [H]/N=C/c1ccc(-c2cc(Nc3ccc(Cl)cc3)nc(N3CCOCC3)n2)cc1N |
| InChI | InChI=1S/C21H21ClN6O/c22-16-3-5-17(6-4-16)25-20-12-19(14-1-2-15(13-23)18(24)11-14)26-21(27-20)28-7-9-29-10-8-28/h1-6,11-13,23H,7-10,24H2,(H,25,26,27)/b23-13+ |
| InChIKey | BXVHZHKMFMJHSR-YDZHTSKRSA-N |
| XLogP | 3.96 |
| TPSA | 100.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.89 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|