C26H28N6O3 — CID 145062296
4-[[6-[3-(cyclobutylamino)-4-methanimidoylphenyl]-2-morpholin-4-ylpyrimidin-4-yl]amino]benzoic acid (PubChem CID 145062296) has the molecular formula C26H28N6O3 and a molecular weight of 472.55 g/mol. Its IUPAC name is 4-[[6-[3-(cyclobutylamino)-4-methanimidoylphenyl]-2-morpholin-4-ylpyrimidin-4-yl]amino]benzoic acid.
| Compound Name | 4-[[6-[3-(cyclobutylamino)-4-methanimidoylphenyl]-2-morpholin-4-ylpyrimidin-4-yl]amino]benzoic acid |
|---|---|
| PubChem CID | 145062296 |
| Molecular Formula | C26H28N6O3 |
| Molecular Weight | 472.55 g/mol |
| Exact Mass | 472.22 |
| IUPAC Name | 4-[[6-[3-(cyclobutylamino)-4-methanimidoylphenyl]-2-morpholin-4-ylpyrimidin-4-yl]amino]benzoic acid |
| SMILES | [H]/N=C/c1ccc(-c2cc(Nc3ccc(C(=O)O)cc3)nc(N3CCOCC3)n2)cc1NC1CCC1 |
| InChI | InChI=1S/C26H28N6O3/c27-16-19-5-4-18(14-22(19)28-20-2-1-3-20)23-15-24(29-21-8-6-17(7-9-21)25(33)34)31-26(30-23)32-10-12-35-13-11-32/h4-9,14-16,20,27-28H,1-3,10-13H2,(H,33,34)(H,29,30,31)/b27-16+ |
| InChIKey | ASWFXOXKEAMZJM-JVWAILMASA-N |
| XLogP | 4.38 |
| TPSA | 123.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.55 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|