C26H25N7O2 — CID 123568175
N-[3-[4-(4-amino-3-methanimidoylanilino)quinazolin-2-yl]phenyl]morpholine-4-carboxamide (PubChem CID 123568175) has the molecular formula C26H25N7O2 and a molecular weight of 467.53 g/mol. Its IUPAC name is N-[3-[4-(4-amino-3-methanimidoylanilino)quinazolin-2-yl]phenyl]morpholine-4-carboxamide.
| Compound Name | N-[3-[4-(4-amino-3-methanimidoylanilino)quinazolin-2-yl]phenyl]morpholine-4-carboxamide |
|---|---|
| PubChem CID | 123568175 |
| Molecular Formula | C26H25N7O2 |
| Molecular Weight | 467.53 g/mol |
| Exact Mass | 467.21 |
| IUPAC Name | N-[3-[4-(4-amino-3-methanimidoylanilino)quinazolin-2-yl]phenyl]morpholine-4-carboxamide |
| SMILES | [H]/N=C/c1cc(Nc2nc(-c3cccc(NC(=O)N4CCOCC4)c3)nc3ccccc23)ccc1N |
| InChI | InChI=1S/C26H25N7O2/c27-16-18-15-20(8-9-22(18)28)29-25-21-6-1-2-7-23(21)31-24(32-25)17-4-3-5-19(14-17)30-26(34)33-10-12-35-13-11-33/h1-9,14-16,27H,10-13,28H2,(H,30,34)(H,29,31,32)/b27-16+ |
| InChIKey | QBBPPGPBSLHXMW-JVWAILMASA-N |
| XLogP | 4.48 |
| TPSA | 129.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.53 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|