C25H25N7O — CID 91501392
N-[3-[4-(4-amino-3-methanimidoylanilino)quinazolin-2-yl]cyclohepta-1,3,6-trien-1-yl]-2-(methylamino)acetamide (PubChem CID 91501392) has the molecular formula C25H25N7O and a molecular weight of 439.52 g/mol. Its IUPAC name is N-[3-[4-(4-amino-3-methanimidoylanilino)quinazolin-2-yl]cyclohepta-1,3,6-trien-1-yl]-2-(methylamino)acetamide.
| Compound Name | N-[3-[4-(4-amino-3-methanimidoylanilino)quinazolin-2-yl]cyclohepta-1,3,6-trien-1-yl]-2-(methylamino)acetamide |
|---|---|
| PubChem CID | 91501392 |
| Molecular Formula | C25H25N7O |
| Molecular Weight | 439.52 g/mol |
| Exact Mass | 439.21 |
| IUPAC Name | N-[3-[4-(4-amino-3-methanimidoylanilino)quinazolin-2-yl]cyclohepta-1,3,6-trien-1-yl]-2-(methylamino)acetamide |
| SMILES | [H]/N=C/c1cc(Nc2nc(C3=CCC=CC(NC(=O)CNC)=C3)nc3ccccc23)ccc1N |
| InChI | InChI=1S/C25H25N7O/c1-28-15-23(33)29-18-7-3-2-6-16(12-18)24-31-22-9-5-4-8-20(22)25(32-24)30-19-10-11-21(27)17(13-19)14-26/h3-14,26,28H,2,15,27H2,1H3,(H,29,33)(H,30,31,32)/b26-14+ |
| InChIKey | OHMVRSMGUQAVJI-VULFUBBASA-N |
| XLogP | 3.52 |
| TPSA | 128.81 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.52 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|