C15H14N6O2S — CID 143557169
methyl 2-amino-4-(4-amino-3-methanimidoylanilino)thieno[2,3-d]pyrimidine-6-carboxylate (PubChem CID 143557169) has the molecular formula C15H14N6O2S and a molecular weight of 342.38 g/mol. Its IUPAC name is methyl 2-amino-4-(4-amino-3-methanimidoylanilino)thieno[2,3-d]pyrimidine-6-carboxylate.
| Compound Name | methyl 2-amino-4-(4-amino-3-methanimidoylanilino)thieno[2,3-d]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 143557169 |
| Molecular Formula | C15H14N6O2S |
| Molecular Weight | 342.38 g/mol |
| Exact Mass | 342.09 |
| IUPAC Name | methyl 2-amino-4-(4-amino-3-methanimidoylanilino)thieno[2,3-d]pyrimidine-6-carboxylate |
| SMILES | [H]/N=C/c1cc(Nc2nc(N)nc3sc(C(=O)OC)cc23)ccc1N |
| InChI | InChI=1S/C15H14N6O2S/c1-23-14(22)11-5-9-12(20-15(18)21-13(9)24-11)19-8-2-3-10(17)7(4-8)6-16/h2-6,16H,17H2,1H3,(H3,18,19,20,21)/b16-6+ |
| InChIKey | ZNTWMTCMQBXHPC-OMCISZLKSA-N |
| XLogP | 2.38 |
| TPSA | 140.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.38 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|