C23H23FN6O2 — CID 144602516
2-[3-[4-(4-amino-3-methanimidoylanilino)-5-methylpyrimidin-2-yl]-4-fluorophenoxy]-N-cyclopropylacetamide (PubChem CID 144602516) has the molecular formula C23H23FN6O2 and a molecular weight of 434.48 g/mol. Its IUPAC name is 2-[3-[4-(4-amino-3-methanimidoylanilino)-5-methylpyrimidin-2-yl]-4-fluorophenoxy]-N-cyclopropylacetamide.
| Compound Name | 2-[3-[4-(4-amino-3-methanimidoylanilino)-5-methylpyrimidin-2-yl]-4-fluorophenoxy]-N-cyclopropylacetamide |
|---|---|
| PubChem CID | 144602516 |
| Molecular Formula | C23H23FN6O2 |
| Molecular Weight | 434.48 g/mol |
| Exact Mass | 434.19 |
| IUPAC Name | 2-[3-[4-(4-amino-3-methanimidoylanilino)-5-methylpyrimidin-2-yl]-4-fluorophenoxy]-N-cyclopropylacetamide |
| SMILES | [H]/N=C/c1cc(Nc2nc(-c3cc(OCC(=O)NC4CC4)ccc3F)ncc2C)ccc1N |
| InChI | InChI=1S/C23H23FN6O2/c1-13-11-27-23(30-22(13)29-16-4-7-20(26)14(8-16)10-25)18-9-17(5-6-19(18)24)32-12-21(31)28-15-2-3-15/h4-11,15,25H,2-3,12,26H2,1H3,(H,28,31)(H,27,29,30)/b25-10+ |
| InChIKey | AIHXOMSRTUXZJE-KIBLKLHPSA-N |
| XLogP | 3.57 |
| TPSA | 126.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.48 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|