C24H28N6O2S — CID 163851251
4-[4-(4-amino-3-methanimidoylanilino)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-7-yl]-N-(oxetan-3-yl)butanamide (PubChem CID 163851251) has the molecular formula C24H28N6O2S and a molecular weight of 464.60 g/mol. Its IUPAC name is 4-[4-(4-amino-3-methanimidoylanilino)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-7-yl]-N-(oxetan-3-yl)butanamide.
| Compound Name | 4-[4-(4-amino-3-methanimidoylanilino)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-7-yl]-N-(oxetan-3-yl)butanamide |
|---|---|
| PubChem CID | 163851251 |
| Molecular Formula | C24H28N6O2S |
| Molecular Weight | 464.60 g/mol |
| Exact Mass | 464.20 |
| IUPAC Name | 4-[4-(4-amino-3-methanimidoylanilino)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-7-yl]-N-(oxetan-3-yl)butanamide |
| SMILES | [H]/N=C/c1cc(Nc2ncnc3sc4c(c23)CCC(CCCC(=O)NC2COC2)C4)ccc1N |
| InChI | InChI=1S/C24H28N6O2S/c25-10-15-9-16(5-7-19(15)26)30-23-22-18-6-4-14(8-20(18)33-24(22)28-13-27-23)2-1-3-21(31)29-17-11-32-12-17/h5,7,9-10,13-14,17,25H,1-4,6,8,11-12,26H2,(H,29,31)(H,27,28,30)/b25-10+ |
| InChIKey | OUOAQPCTTIQMBM-KIBLKLHPSA-N |
| XLogP | 3.80 |
| TPSA | 126.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.60 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|