C23H27N5O3S — CID 152954381
4-[4-(4-amino-2-ethoxy-5-methanimidoylanilino)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-7-yl]butanoic acid (PubChem CID 152954381) has the molecular formula C23H27N5O3S and a molecular weight of 453.57 g/mol. Its IUPAC name is 4-[4-(4-amino-2-ethoxy-5-methanimidoylanilino)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-7-yl]butanoic acid.
| Compound Name | 4-[4-(4-amino-2-ethoxy-5-methanimidoylanilino)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-7-yl]butanoic acid |
|---|---|
| PubChem CID | 152954381 |
| Molecular Formula | C23H27N5O3S |
| Molecular Weight | 453.57 g/mol |
| Exact Mass | 453.18 |
| IUPAC Name | 4-[4-(4-amino-2-ethoxy-5-methanimidoylanilino)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-7-yl]butanoic acid |
| SMILES | [H]/N=C/c1cc(Nc2ncnc3sc4c(c23)CCC(CCCC(=O)O)C4)c(OCC)cc1N |
| InChI | InChI=1S/C23H27N5O3S/c1-2-31-18-10-16(25)14(11-24)9-17(18)28-22-21-15-7-6-13(4-3-5-20(29)30)8-19(15)32-23(21)27-12-26-22/h9-13,24H,2-8,25H2,1H3,(H,29,30)(H,26,27,28)/b24-11+ |
| InChIKey | UPIGMTGZVYUOQH-BHGWPJFGSA-N |
| XLogP | 4.77 |
| TPSA | 134.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.57 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|