C23H27FN6OS — CID 144847558
2-[3-(3-fluoroazetidin-1-yl)propoxy]-5-methanimidoyl-1-N-(5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)benzene-1,4-diamine (PubChem CID 144847558) has the molecular formula C23H27FN6OS and a molecular weight of 454.58 g/mol. Its IUPAC name is 2-[3-(3-fluoroazetidin-1-yl)propoxy]-5-methanimidoyl-1-N-(5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)benzene-1,4-diamine.
| Compound Name | 2-[3-(3-fluoroazetidin-1-yl)propoxy]-5-methanimidoyl-1-N-(5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 144847558 |
| Molecular Formula | C23H27FN6OS |
| Molecular Weight | 454.58 g/mol |
| Exact Mass | 454.20 |
| IUPAC Name | 2-[3-(3-fluoroazetidin-1-yl)propoxy]-5-methanimidoyl-1-N-(5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)benzene-1,4-diamine |
| SMILES | [H]/N=C/c1cc(Nc2ncnc3sc4c(c23)CCCC4)c(OCCCN2CC(F)C2)cc1N |
| InChI | InChI=1S/C23H27FN6OS/c24-15-11-30(12-15)6-3-7-31-19-9-17(26)14(10-25)8-18(19)29-22-21-16-4-1-2-5-20(16)32-23(21)28-13-27-22/h8-10,13,15,25H,1-7,11-12,26H2,(H,27,28,29)/b25-10+ |
| InChIKey | RYQFSEKADBTYGG-KIBLKLHPSA-N |
| XLogP | 4.32 |
| TPSA | 100.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.58 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|