C23H30N6OS2 — CID 144847771
2-methanimidoyl-5-methylsulfanyl-4-N-(5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)benzene-1,4-diamine;N-methyl-N-propan-2-ylformamide (PubChem CID 144847771) has the molecular formula C23H30N6OS2 and a molecular weight of 470.67 g/mol. Its IUPAC name is 2-methanimidoyl-5-methylsulfanyl-4-N-(5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)benzene-1,4-diamine;N-methyl-N-propan-2-ylformamide.
| Compound Name | 2-methanimidoyl-5-methylsulfanyl-4-N-(5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)benzene-1,4-diamine;N-methyl-N-propan-2-ylformamide |
|---|---|
| PubChem CID | 144847771 |
| Molecular Formula | C23H30N6OS2 |
| Molecular Weight | 470.67 g/mol |
| Exact Mass | 470.19 |
| IUPAC Name | 2-methanimidoyl-5-methylsulfanyl-4-N-(5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)benzene-1,4-diamine;N-methyl-N-propan-2-ylformamide |
| SMILES | CC(C)N(C)C=O.[H]/N=C/c1cc(Nc2ncnc3sc4c(c23)CCCC4)c(SC)cc1N |
| InChI | InChI=1S/C18H19N5S2.C5H11NO/c1-24-15-7-12(20)10(8-19)6-13(15)23-17-16-11-4-2-3-5-14(11)25-18(16)22-9-21-17;1-5(2)6(3)4-7/h6-9,19H,2-5,20H2,1H3,(H,21,22,23);4-5H,1-3H3/b19-8+; |
| InChIKey | VLEULZFXPMDNHA-BTSUEJIHSA-N |
| XLogP | 5.10 |
| TPSA | 107.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.67 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|