C24H28N6O3S — CID 144847803
2-methanimidoyl-5-methoxy-4-N-(5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)benzene-1,4-diamine;2-oxa-6-azaspiro[3.3]heptane-6-carbaldehyde (PubChem CID 144847803) has the molecular formula C24H28N6O3S and a molecular weight of 480.59 g/mol. Its IUPAC name is 2-methanimidoyl-5-methoxy-4-N-(5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)benzene-1,4-diamine;2-oxa-6-azaspiro[3.3]heptane-6-carbaldehyde.
| Compound Name | 2-methanimidoyl-5-methoxy-4-N-(5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)benzene-1,4-diamine;2-oxa-6-azaspiro[3.3]heptane-6-carbaldehyde |
|---|---|
| PubChem CID | 144847803 |
| Molecular Formula | C24H28N6O3S |
| Molecular Weight | 480.59 g/mol |
| Exact Mass | 480.19 |
| IUPAC Name | 2-methanimidoyl-5-methoxy-4-N-(5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)benzene-1,4-diamine;2-oxa-6-azaspiro[3.3]heptane-6-carbaldehyde |
| SMILES | O=CN1CC2(COC2)C1.[H]/N=C/c1cc(Nc2ncnc3sc4c(c23)CCCC4)c(OC)cc1N |
| InChI | InChI=1S/C18H19N5OS.C6H9NO2/c1-24-14-7-12(20)10(8-19)6-13(14)23-17-16-11-4-2-3-5-15(11)25-18(16)22-9-21-17;8-5-7-1-6(2-7)3-9-4-6/h6-9,19H,2-5,20H2,1H3,(H,21,22,23);5H,1-4H2/b19-8+; |
| InChIKey | UXNHWZVVZYTBPB-BTSUEJIHSA-N |
| XLogP | 3.38 |
| TPSA | 126.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.59 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|