C25H33N7O3S — CID 144847537
2-(2-aminoethoxy)-5-methanimidoyl-1-N-(5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)benzene-1,4-diamine;3-methylmorpholine-4-carbaldehyde (PubChem CID 144847537) has the molecular formula C25H33N7O3S and a molecular weight of 511.65 g/mol. Its IUPAC name is 2-(2-aminoethoxy)-5-methanimidoyl-1-N-(5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)benzene-1,4-diamine;3-methylmorpholine-4-carbaldehyde.
| Compound Name | 2-(2-aminoethoxy)-5-methanimidoyl-1-N-(5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)benzene-1,4-diamine;3-methylmorpholine-4-carbaldehyde |
|---|---|
| PubChem CID | 144847537 |
| Molecular Formula | C25H33N7O3S |
| Molecular Weight | 511.65 g/mol |
| Exact Mass | 511.24 |
| IUPAC Name | 2-(2-aminoethoxy)-5-methanimidoyl-1-N-(5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)benzene-1,4-diamine;3-methylmorpholine-4-carbaldehyde |
| SMILES | CC1COCCN1C=O.[H]/N=C/c1cc(Nc2ncnc3sc4c(c23)CCCC4)c(OCCN)cc1N |
| InChI | InChI=1S/C19H22N6OS.C6H11NO2/c20-5-6-26-15-8-13(22)11(9-21)7-14(15)25-18-17-12-3-1-2-4-16(12)27-19(17)24-10-23-18;1-6-4-9-3-2-7(6)5-8/h7-10,21H,1-6,20,22H2,(H,23,24,25);5-6H,2-4H2,1H3/b21-9+; |
| InChIKey | MLFFGQMPHZSUMP-CSFJJMQLSA-N |
| XLogP | 3.09 |
| TPSA | 152.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.65 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|