C23H29N7O3S — CID 144771438
3-methanimidoyl-6-methoxy-5-N-(5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)pyridine-2,5-diamine;(3R)-3-methylmorpholine-4-carbaldehyde (PubChem CID 144771438) has the molecular formula C23H29N7O3S and a molecular weight of 483.60 g/mol. Its IUPAC name is 3-methanimidoyl-6-methoxy-5-N-(5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)pyridine-2,5-diamine;(3R)-3-methylmorpholine-4-carbaldehyde.
| Compound Name | 3-methanimidoyl-6-methoxy-5-N-(5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)pyridine-2,5-diamine;(3R)-3-methylmorpholine-4-carbaldehyde |
|---|---|
| PubChem CID | 144771438 |
| Molecular Formula | C23H29N7O3S |
| Molecular Weight | 483.60 g/mol |
| Exact Mass | 483.21 |
| IUPAC Name | 3-methanimidoyl-6-methoxy-5-N-(5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)pyridine-2,5-diamine;(3R)-3-methylmorpholine-4-carbaldehyde |
| SMILES | C[C@@H]1COCCN1C=O.[H]/N=C/c1cc(Nc2ncnc3sc4c(c23)CCCC4)c(OC)nc1N |
| InChI | InChI=1S/C17H18N6OS.C6H11NO2/c1-24-16-11(6-9(7-18)14(19)23-16)22-15-13-10-4-2-3-5-12(10)25-17(13)21-8-20-15;1-6-4-9-3-2-7(6)5-8/h6-8,18H,2-5H2,1H3,(H2,19,23)(H,20,21,22);5-6H,2-4H2,1H3/b18-7+;/t;6-/m.1/s1 |
| InChIKey | RBTCVHVWXHRBMW-JJVXHMRYSA-N |
| XLogP | 3.16 |
| TPSA | 139.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.60 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|