C16H16N6S — CID 144771347
3-methanimidoyl-5-N-(5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)pyridine-2,5-diamine (PubChem CID 144771347) has the molecular formula C16H16N6S and a molecular weight of 324.41 g/mol. Its IUPAC name is 3-methanimidoyl-5-N-(5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)pyridine-2,5-diamine.
| Compound Name | 3-methanimidoyl-5-N-(5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)pyridine-2,5-diamine |
|---|---|
| PubChem CID | 144771347 |
| Molecular Formula | C16H16N6S |
| Molecular Weight | 324.41 g/mol |
| Exact Mass | 324.12 |
| IUPAC Name | 3-methanimidoyl-5-N-(5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)pyridine-2,5-diamine |
| SMILES | [H]/N=C/c1cc(Nc2ncnc3sc4c(c23)CCCC4)cnc1N |
| InChI | InChI=1S/C16H16N6S/c17-6-9-5-10(7-19-14(9)18)22-15-13-11-3-1-2-4-12(11)23-16(13)21-8-20-15/h5-8,17H,1-4H2,(H2,18,19)(H,20,21,22)/b17-6+ |
| InChIKey | DWVUTZGFSOOYGL-UBKPWBPPSA-N |
| XLogP | 3.29 |
| TPSA | 100.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.41 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|