C20H23N5O2S — CID 144847696
ethyl formate;2-methanimidoyl-4-N-(5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)benzene-1,4-diamine (PubChem CID 144847696) has the molecular formula C20H23N5O2S and a molecular weight of 397.50 g/mol. Its IUPAC name is ethyl formate;2-methanimidoyl-4-N-(5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)benzene-1,4-diamine.
| Compound Name | ethyl formate;2-methanimidoyl-4-N-(5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 144847696 |
| Molecular Formula | C20H23N5O2S |
| Molecular Weight | 397.50 g/mol |
| Exact Mass | 397.16 |
| IUPAC Name | ethyl formate;2-methanimidoyl-4-N-(5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)benzene-1,4-diamine |
| SMILES | CCOC=O.[H]/N=C/c1cc(Nc2ncnc3sc4c(c23)CCCC4)ccc1N |
| InChI | InChI=1S/C17H17N5S.C3H6O2/c18-8-10-7-11(5-6-13(10)19)22-16-15-12-3-1-2-4-14(12)23-17(15)21-9-20-16;1-2-5-3-4/h5-9,18H,1-4,19H2,(H,20,21,22);3H,2H2,1H3/b18-8+; |
| InChIKey | AAQGYKWQVINNCI-JUIXXEQESA-N |
| XLogP | 4.07 |
| TPSA | 113.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.50 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|