C20H24N4O3S2 — CID 144966945
2-amino-4-methoxy-5-(5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-ylamino)benzenethiol;ethyl formate (PubChem CID 144966945) has the molecular formula C20H24N4O3S2 and a molecular weight of 432.57 g/mol. Its IUPAC name is 2-amino-4-methoxy-5-(5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-ylamino)benzenethiol;ethyl formate.
| Compound Name | 2-amino-4-methoxy-5-(5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-ylamino)benzenethiol;ethyl formate |
|---|---|
| PubChem CID | 144966945 |
| Molecular Formula | C20H24N4O3S2 |
| Molecular Weight | 432.57 g/mol |
| Exact Mass | 432.13 |
| IUPAC Name | 2-amino-4-methoxy-5-(5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-ylamino)benzenethiol;ethyl formate |
| SMILES | CCOC=O.COc1cc(N)c(S)cc1Nc1ncnc2sc3c(c12)CCCC3 |
| InChI | InChI=1S/C17H18N4OS2.C3H6O2/c1-22-12-6-10(18)13(23)7-11(12)21-16-15-9-4-2-3-5-14(9)24-17(15)20-8-19-16;1-2-5-3-4/h6-8,23H,2-5,18H2,1H3,(H,19,20,21);3H,2H2,1H3 |
| InChIKey | VEIHRGCOJAYXLO-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 99.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.57 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|