C20H25N5O2S3 — CID 144966898
2-amino-4-methoxy-5-(5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-ylamino)benzenethiol;N-methyl-N-methylsulfanylformamide (PubChem CID 144966898) has the molecular formula C20H25N5O2S3 and a molecular weight of 463.65 g/mol. Its IUPAC name is 2-amino-4-methoxy-5-(5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-ylamino)benzenethiol;N-methyl-N-methylsulfanylformamide.
| Compound Name | 2-amino-4-methoxy-5-(5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-ylamino)benzenethiol;N-methyl-N-methylsulfanylformamide |
|---|---|
| PubChem CID | 144966898 |
| Molecular Formula | C20H25N5O2S3 |
| Molecular Weight | 463.65 g/mol |
| Exact Mass | 463.12 |
| IUPAC Name | 2-amino-4-methoxy-5-(5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-ylamino)benzenethiol;N-methyl-N-methylsulfanylformamide |
| SMILES | COc1cc(N)c(S)cc1Nc1ncnc2sc3c(c12)CCCC3.CSN(C)C=O |
| InChI | InChI=1S/C17H18N4OS2.C3H7NOS/c1-22-12-6-10(18)13(23)7-11(12)21-16-15-9-4-2-3-5-14(9)24-17(15)20-8-19-16;1-4(3-5)6-2/h6-8,23H,2-5,18H2,1H3,(H,19,20,21);3H,1-2H3 |
| InChIKey | XVXUKHXJPVQZLH-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 93.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.65 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|