C22H29N5OS2 — CID 144966918
2-amino-4-ethyl-5-(5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-ylamino)benzenethiol;N-ethyl-N-methylformamide (PubChem CID 144966918) has the molecular formula C22H29N5OS2 and a molecular weight of 443.64 g/mol. Its IUPAC name is 2-amino-4-ethyl-5-(5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-ylamino)benzenethiol;N-ethyl-N-methylformamide.
| Compound Name | 2-amino-4-ethyl-5-(5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-ylamino)benzenethiol;N-ethyl-N-methylformamide |
|---|---|
| PubChem CID | 144966918 |
| Molecular Formula | C22H29N5OS2 |
| Molecular Weight | 443.64 g/mol |
| Exact Mass | 443.18 |
| IUPAC Name | 2-amino-4-ethyl-5-(5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-ylamino)benzenethiol;N-ethyl-N-methylformamide |
| SMILES | CCN(C)C=O.CCc1cc(N)c(S)cc1Nc1ncnc2sc3c(c12)CCCC3 |
| InChI | InChI=1S/C18H20N4S2.C4H9NO/c1-2-10-7-12(19)14(23)8-13(10)22-17-16-11-5-3-4-6-15(11)24-18(16)21-9-20-17;1-3-5(2)4-6/h7-9,23H,2-6,19H2,1H3,(H,20,21,22);4H,3H2,1-2H3 |
| InChIKey | XFOVLZQOOPGVOX-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 84.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.64 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|