C22H24ClN5O2S2 — CID 144966924
2-amino-4-chloro-5-(5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-ylamino)benzenethiol;4-oxopiperidine-1-carbaldehyde (PubChem CID 144966924) has the molecular formula C22H24ClN5O2S2 and a molecular weight of 490.05 g/mol. Its IUPAC name is 2-amino-4-chloro-5-(5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-ylamino)benzenethiol;4-oxopiperidine-1-carbaldehyde.
| Compound Name | 2-amino-4-chloro-5-(5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-ylamino)benzenethiol;4-oxopiperidine-1-carbaldehyde |
|---|---|
| PubChem CID | 144966924 |
| Molecular Formula | C22H24ClN5O2S2 |
| Molecular Weight | 490.05 g/mol |
| Exact Mass | 489.11 |
| IUPAC Name | 2-amino-4-chloro-5-(5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-ylamino)benzenethiol;4-oxopiperidine-1-carbaldehyde |
| SMILES | Nc1cc(Cl)c(Nc2ncnc3sc4c(c23)CCCC4)cc1S.O=CN1CCC(=O)CC1 |
| InChI | InChI=1S/C16H15ClN4S2.C6H9NO2/c17-9-5-10(18)12(22)6-11(9)21-15-14-8-3-1-2-4-13(8)23-16(14)20-7-19-15;8-5-7-3-1-6(9)2-4-7/h5-7,22H,1-4,18H2,(H,19,20,21);5H,1-4H2 |
| InChIKey | NXKWPHQVGQRPFR-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 101.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.05 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|