C21H27N5OS2 — CID 144966885
2-amino-4-methoxy-5-(5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-ylamino)benzenethiol;3-methylazetidine (PubChem CID 144966885) has the molecular formula C21H27N5OS2 and a molecular weight of 429.62 g/mol. Its IUPAC name is 2-amino-4-methoxy-5-(5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-ylamino)benzenethiol;3-methylazetidine.
| Compound Name | 2-amino-4-methoxy-5-(5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-ylamino)benzenethiol;3-methylazetidine |
|---|---|
| PubChem CID | 144966885 |
| Molecular Formula | C21H27N5OS2 |
| Molecular Weight | 429.62 g/mol |
| Exact Mass | 429.17 |
| IUPAC Name | 2-amino-4-methoxy-5-(5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-ylamino)benzenethiol;3-methylazetidine |
| SMILES | CC1CNC1.COc1cc(N)c(S)cc1Nc1ncnc2sc3c(c12)CCCC3 |
| InChI | InChI=1S/C17H18N4OS2.C4H9N/c1-22-12-6-10(18)13(23)7-11(12)21-16-15-9-4-2-3-5-14(9)24-17(15)20-8-19-16;1-4-2-5-3-4/h6-8,23H,2-5,18H2,1H3,(H,19,20,21);4-5H,2-3H2,1H3 |
| InChIKey | HHNOJTSWMZEXDR-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 85.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.62 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|