C22H27N7OS — CID 144966810
2-methanimidoyl-4-N-[11-(2-morpholin-4-ylethyl)-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-yl]benzene-1,4-diamine (PubChem CID 144966810) has the molecular formula C22H27N7OS and a molecular weight of 437.57 g/mol. Its IUPAC name is 2-methanimidoyl-4-N-[11-(2-morpholin-4-ylethyl)-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-yl]benzene-1,4-diamine.
| Compound Name | 2-methanimidoyl-4-N-[11-(2-morpholin-4-ylethyl)-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-yl]benzene-1,4-diamine |
|---|---|
| PubChem CID | 144966810 |
| Molecular Formula | C22H27N7OS |
| Molecular Weight | 437.57 g/mol |
| Exact Mass | 437.20 |
| IUPAC Name | 2-methanimidoyl-4-N-[11-(2-morpholin-4-ylethyl)-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-yl]benzene-1,4-diamine |
| SMILES | [H]/N=C/c1cc(Nc2ncnc3sc4c(c23)CCN(CCN2CCOCC2)C4)ccc1N |
| InChI | InChI=1S/C22H27N7OS/c23-12-15-11-16(1-2-18(15)24)27-21-20-17-3-4-29(6-5-28-7-9-30-10-8-28)13-19(17)31-22(20)26-14-25-21/h1-2,11-12,14,23H,3-10,13,24H2,(H,25,26,27)/b23-12+ |
| InChIKey | YQAWXRZWXYMHBA-FSJBWODESA-N |
| XLogP | 2.71 |
| TPSA | 103.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.57 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|