C19H19F3N6OS — CID 123937415
2-methanimidoyl-5-methoxy-4-N-[11-(2,2,2-trifluoroethyl)-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-yl]benzene-1,4-diamine (PubChem CID 123937415) has the molecular formula C19H19F3N6OS and a molecular weight of 436.46 g/mol. Its IUPAC name is 2-methanimidoyl-5-methoxy-4-N-[11-(2,2,2-trifluoroethyl)-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-yl]benzene-1,4-diamine.
| Compound Name | 2-methanimidoyl-5-methoxy-4-N-[11-(2,2,2-trifluoroethyl)-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-yl]benzene-1,4-diamine |
|---|---|
| PubChem CID | 123937415 |
| Molecular Formula | C19H19F3N6OS |
| Molecular Weight | 436.46 g/mol |
| Exact Mass | 436.13 |
| IUPAC Name | 2-methanimidoyl-5-methoxy-4-N-[11-(2,2,2-trifluoroethyl)-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-yl]benzene-1,4-diamine |
| SMILES | [H]/N=C/c1cc(Nc2ncnc3sc4c(c23)CCN(CC(F)(F)F)C4)c(OC)cc1N |
| InChI | InChI=1S/C19H19F3N6OS/c1-29-14-5-12(24)10(6-23)4-13(14)27-17-16-11-2-3-28(8-19(20,21)22)7-15(11)30-18(16)26-9-25-17/h4-6,9,23H,2-3,7-8,24H2,1H3,(H,25,26,27)/b23-6+ |
| InChIKey | SIEOSPXVPBGEFR-TXNBCWFRSA-N |
| XLogP | 3.94 |
| TPSA | 100.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.46 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|